C9H17FO3S — CID 102533422
methyl (2R)-2-ethylsulfanyl-2-fluoro-3-hydroxyhexanoate (PubChem CID 102533422) has the molecular formula C9H17FO3S and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (2R)-2-ethylsulfanyl-2-fluoro-3-hydroxyhexanoate.
| Compound Name | methyl (2R)-2-ethylsulfanyl-2-fluoro-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 102533422 |
| Molecular Formula | C9H17FO3S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | methyl (2R)-2-ethylsulfanyl-2-fluoro-3-hydroxyhexanoate |
| SMILES | CCCC(O)[C@@](F)(SCC)C(=O)OC |
| InChI | InChI=1S/C9H17FO3S/c1-4-6-7(11)9(10,14-5-2)8(12)13-3/h7,11H,4-6H2,1-3H3/t7?,9-/m1/s1 |
| InChIKey | ZSDHVNMXWJIUAQ-NHSZFOGYSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |