C11H21FO4S — CID 101056689
methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyhexanoate (PubChem CID 101056689) has the molecular formula C11H21FO4S and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyhexanoate.
| Compound Name | methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 101056689 |
| Molecular Formula | C11H21FO4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyhexanoate |
| SMILES | CCC[C@H](O)[C@](F)(C(=O)OC)S(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21FO4S/c1-6-7-8(13)11(12,9(14)16-5)17(15)10(2,3)4/h8,13H,6-7H2,1-5H3/t8-,11+,17?/m0/s1 |
| InChIKey | XKQFFHJQNUWODH-ACANBVQXSA-N |
| XLogP | 1.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |