C13H25FO4S — CID 101056692
methyl (2S,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyoctanoate (PubChem CID 101056692) has the molecular formula C13H25FO4S and a molecular weight of 296.40 g/mol. Its IUPAC name is methyl (2S,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyoctanoate.
| Compound Name | methyl (2S,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyoctanoate |
|---|---|
| PubChem CID | 101056692 |
| Molecular Formula | C13H25FO4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl (2S,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyoctanoate |
| SMILES | CCCCC[C@H](O)[C@@](F)(C(=O)OC)S(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25FO4S/c1-6-7-8-9-10(15)13(14,11(16)18-5)19(17)12(2,3)4/h10,15H,6-9H2,1-5H3/t10-,13-,19?/m0/s1 |
| InChIKey | IGACIIJCZTZUMA-MOLGBSNYSA-N |
| XLogP | 2.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|