C16H31FO4S — CID 101056686
methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyundecanoate (PubChem CID 101056686) has the molecular formula C16H31FO4S and a molecular weight of 338.49 g/mol. Its IUPAC name is methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyundecanoate.
| Compound Name | methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyundecanoate |
|---|---|
| PubChem CID | 101056686 |
| Molecular Formula | C16H31FO4S |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | methyl (2R,3S)-2-tert-butylsulfinyl-2-fluoro-3-hydroxyundecanoate |
| SMILES | CCCCCCCC[C@H](O)[C@](F)(C(=O)OC)S(=O)C(C)(C)C |
| InChI | InChI=1S/C16H31FO4S/c1-6-7-8-9-10-11-12-13(18)16(17,14(19)21-5)22(20)15(2,3)4/h13,18H,6-12H2,1-5H3/t13-,16+,22?/m0/s1 |
| InChIKey | UEHLDUKDWLCQKU-NYXVRBHRSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|