C15H11NO4S — CID 102533875
3-(1,3-dioxoisoindol-2-yl)-3-thiophen-2-ylpropanoic acid (PubChem CID 102533875) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 102533875 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(c1cccs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H11NO4S/c17-13(18)8-11(12-6-3-7-21-12)16-14(19)9-4-1-2-5-10(9)15(16)20/h1-7,11H,8H2,(H,17,18) |
| InChIKey | KWEOBIDWUCNXQZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|