About (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate
(1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate (PubChem CID 10446752) has the molecular formula C14H9NO4S
and a molecular weight of 287.30 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate |
| PubChem CID | 10446752 |
| Molecular Formula | C14H9NO4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H9NO4S/c16-12(7-9-5-6-20-8-9)19-15-13(17)10-3-1-2-4-11(10)14(15)18/h1-6,8H,7H2 |
| InChIKey | AKVMELQJKYJBQM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate (CID 10446752) is (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate is O=C(Cc1ccsc1)ON1C(=O)c2ccccc2C1=O.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate?
The InChIKey is AKVMELQJKYJBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO4S/c16-12(7-9-5-6-20-8-9)19-15-13(17)10-3-1-2-4-11(10)14(15)18/h1-6,8H,7H2.
What are the key properties of (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate?
(1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate has a molecular weight of 287.30 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) 2-thiophen-3-ylacetate is sourced from PubChem (CID 10446752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).