C29H45NO3 — CID 10253513
decanoic acid;N-methyl-3-phenyl-3-(3-propylphenoxy)propan-1-amine (PubChem CID 10253513) has the molecular formula C29H45NO3 and a molecular weight of 455.68 g/mol. Its IUPAC name is decanoic acid;N-methyl-3-phenyl-3-(3-propylphenoxy)propan-1-amine.
| Compound Name | decanoic acid;N-methyl-3-phenyl-3-(3-propylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 10253513 |
| Molecular Formula | C29H45NO3 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | decanoic acid;N-methyl-3-phenyl-3-(3-propylphenoxy)propan-1-amine |
| SMILES | CCCCCCCCCC(=O)O.CCCc1cccc(OC(CCNC)c2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO.C10H20O2/c1-3-8-16-9-7-12-18(15-16)21-19(13-14-20-2)17-10-5-4-6-11-17;1-2-3-4-5-6-7-8-9-10(11)12/h4-7,9-12,15,19-20H,3,8,13-14H2,1-2H3;2-9H2,1H3,(H,11,12) |
| InChIKey | DQLIFZVDLKQKRB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|