C24H35NO3 — CID 90229960
4-[3-(4-hydroxybutyl)-5-[3-(methylamino)-1-phenylpropoxy]phenyl]butan-1-ol (PubChem CID 90229960) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-[3-(4-hydroxybutyl)-5-[3-(methylamino)-1-phenylpropoxy]phenyl]butan-1-ol.
| Compound Name | 4-[3-(4-hydroxybutyl)-5-[3-(methylamino)-1-phenylpropoxy]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 90229960 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 4-[3-(4-hydroxybutyl)-5-[3-(methylamino)-1-phenylpropoxy]phenyl]butan-1-ol |
| SMILES | CNCCC(Oc1cc(CCCCO)cc(CCCCO)c1)c1ccccc1 |
| InChI | InChI=1S/C24H35NO3/c1-25-14-13-24(22-11-3-2-4-12-22)28-23-18-20(9-5-7-15-26)17-21(19-23)10-6-8-16-27/h2-4,11-12,17-19,24-27H,5-10,13-16H2,1H3 |
| InChIKey | OXXHIEZTJAARPQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|