C13H12ClN3O2 — CID 102535616
1-[3-(6-chloro-2H-chromen-3-yl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 102535616) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 1-[3-(6-chloro-2H-chromen-3-yl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | 1-[3-(6-chloro-2H-chromen-3-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 102535616 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-[3-(6-chloro-2H-chromen-3-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | CC(N)c1nc(C2=Cc3cc(Cl)ccc3OC2)no1 |
| InChI | InChI=1S/C13H12ClN3O2/c1-7(15)13-16-12(17-19-13)9-4-8-5-10(14)2-3-11(8)18-6-9/h2-5,7H,6,15H2,1H3 |
| InChIKey | YFRBPISRTLWTLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |