C20H14ClNO3 — CID 18709772
4-[5-(6-chloro-2H-chromen-3-yl)-1H-pyrrol-2-yl]benzoic acid (PubChem CID 18709772) has the molecular formula C20H14ClNO3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 4-[5-(6-chloro-2H-chromen-3-yl)-1H-pyrrol-2-yl]benzoic acid.
| Compound Name | 4-[5-(6-chloro-2H-chromen-3-yl)-1H-pyrrol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18709772 |
| Molecular Formula | C20H14ClNO3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-[5-(6-chloro-2H-chromen-3-yl)-1H-pyrrol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C3=Cc4cc(Cl)ccc4OC3)[nH]2)cc1 |
| InChI | InChI=1S/C20H14ClNO3/c21-16-5-8-19-14(10-16)9-15(11-25-19)18-7-6-17(22-18)12-1-3-13(4-2-12)20(23)24/h1-10,22H,11H2,(H,23,24) |
| InChIKey | SHAWKTNUBWUNNM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |