C13H10ClF3O3 — CID 174375847
3-(6-chloro-2H-chromen-3-yl)-4,4,4-trifluorobutanoic acid (PubChem CID 174375847) has the molecular formula C13H10ClF3O3 and a molecular weight of 306.67 g/mol. Its IUPAC name is 3-(6-chloro-2H-chromen-3-yl)-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-(6-chloro-2H-chromen-3-yl)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 174375847 |
| Molecular Formula | C13H10ClF3O3 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 3-(6-chloro-2H-chromen-3-yl)-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(C1=Cc2cc(Cl)ccc2OC1)C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3O3/c14-9-1-2-11-7(4-9)3-8(6-20-11)10(5-12(18)19)13(15,16)17/h1-4,10H,5-6H2,(H,18,19) |
| InChIKey | RKVUFJIQXAAPOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |