C8H12N4 — CID 102536121
5-[(prop-2-enylamino)methyl]pyrimidin-2-amine (PubChem CID 102536121) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 5-[(prop-2-enylamino)methyl]pyrimidin-2-amine.
| Compound Name | 5-[(prop-2-enylamino)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102536121 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 5-[(prop-2-enylamino)methyl]pyrimidin-2-amine |
| SMILES | C=CCNCc1cnc(N)nc1 |
| InChI | InChI=1S/C8H12N4/c1-2-3-10-4-7-5-11-8(9)12-6-7/h2,5-6,10H,1,3-4H2,(H2,9,11,12) |
| InChIKey | WOHPYPHFCUFKOK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|