C7H11N3S — CID 131206977
5-[(prop-2-enylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 131206977) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-[(prop-2-enylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(prop-2-enylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131206977 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-[(prop-2-enylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | C=CCNCc1cnc(N)s1 |
| InChI | InChI=1S/C7H11N3S/c1-2-3-9-4-6-5-10-7(8)11-6/h2,5,9H,1,3-4H2,(H2,8,10) |
| InChIKey | XVMPTYZEJLPPHK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|