C9H13N3OS2 — CID 43117446
2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 43117446) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 43117446 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1cnc(N)s1 |
| InChI | InChI=1S/C9H13N3OS2/c1-3-4-11-8(13)6(2)14-7-5-12-9(10)15-7/h3,5-6H,1,4H2,2H3,(H2,10,12)(H,11,13) |
| InChIKey | YUFMEXMQQAAOJX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|