C11H13NO3S2 — CID 79149156
4-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylthiophene-2-carboxylic acid (PubChem CID 79149156) has the molecular formula C11H13NO3S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylthiophene-2-carboxylic acid.
| Compound Name | 4-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79149156 |
| Molecular Formula | C11H13NO3S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylthiophene-2-carboxylic acid |
| SMILES | C=CCNC(=O)C(C)Sc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C11H13NO3S2/c1-3-4-12-10(13)7(2)17-8-5-9(11(14)15)16-6-8/h3,5-7H,1,4H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | TXLJCRNDMSWJLR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|