C13H19NO3S2 — CID 79149425
4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]sulfanylthiophene-2-carboxylic acid (PubChem CID 79149425) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]sulfanylthiophene-2-carboxylic acid.
| Compound Name | 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]sulfanylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79149425 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]sulfanylthiophene-2-carboxylic acid |
| SMILES | CCC(C)(C)NC(=O)C(C)Sc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C13H19NO3S2/c1-5-13(3,4)14-11(15)8(2)19-9-6-10(12(16)17)18-7-9/h6-8H,5H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | XNDAYZCYRAJWBI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |