C10H16N4OS — CID 9373231
(2R)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 9373231) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is (2R)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 9373231 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2R)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)Sc1nnc(C)n1C |
| InChI | InChI=1S/C10H16N4OS/c1-5-6-11-9(15)7(2)16-10-13-12-8(3)14(10)4/h5,7H,1,6H2,2-4H3,(H,11,15)/t7-/m1/s1 |
| InChIKey | PCQLFTWCNPZVNT-SSDOTTSWSA-N |
| XLogP | 0.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|