C14H15FN4OS — CID 42896557
2-[[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 42896557) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 42896557 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[[4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1nncn1-c1ccccc1F |
| InChI | InChI=1S/C14H15FN4OS/c1-3-8-16-13(20)10(2)21-14-18-17-9-19(14)12-7-5-4-6-11(12)15/h3-7,9-10H,1,8H2,2H3,(H,16,20) |
| InChIKey | IHINOJVQBVUMML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|