About [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol
[1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol (PubChem CID 120902030) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol |
| PubChem CID | 120902030 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol |
| SMILES | Nc1ncc(CNC2(CO)CCC2)s1 |
| InChI | InChI=1S/C9H15N3OS/c10-8-11-4-7(14-8)5-12-9(6-13)2-1-3-9/h4,12-13H,1-3,5-6H2,(H2,10,11) |
| InChIKey | UAUGOZYHEARPQE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol?
The IUPAC name of [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol (CID 120902030) is [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol.
What is the SMILES notation for [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol?
The canonical SMILES for [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol is Nc1ncc(CNC2(CO)CCC2)s1.
What is the InChIKey of [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol?
The InChIKey is UAUGOZYHEARPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c10-8-11-4-7(14-8)5-12-9(6-13)2-1-3-9/h4,12-13H,1-3,5-6H2,(H2,10,11).
What are the key properties of [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol?
[1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol has a molecular weight of 213.31 g/mol, XLogP of 0.73, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-amino-1,3-thiazol-5-yl)methylamino]cyclobutyl]methanol is sourced from PubChem (CID 120902030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).