C11H18N2OS — CID 62759471
[1-(1,3-thiazol-5-ylmethylamino)cyclohexyl]methanol (PubChem CID 62759471) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-ylmethylamino)cyclohexyl]methanol.
| Compound Name | [1-(1,3-thiazol-5-ylmethylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 62759471 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [1-(1,3-thiazol-5-ylmethylamino)cyclohexyl]methanol |
| SMILES | OCC1(NCc2cncs2)CCCCC1 |
| InChI | InChI=1S/C11H18N2OS/c14-8-11(4-2-1-3-5-11)13-7-10-6-12-9-15-10/h6,9,13-14H,1-5,7-8H2 |
| InChIKey | IGNGEYCGPZHQAS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |