C17H22N2OS — CID 62900743
[1-[(4-phenyl-1,3-thiazol-2-yl)methylamino]cyclohexyl]methanol (PubChem CID 62900743) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is [1-[(4-phenyl-1,3-thiazol-2-yl)methylamino]cyclohexyl]methanol.
| Compound Name | [1-[(4-phenyl-1,3-thiazol-2-yl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 62900743 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [1-[(4-phenyl-1,3-thiazol-2-yl)methylamino]cyclohexyl]methanol |
| SMILES | OCC1(NCc2nc(-c3ccccc3)cs2)CCCCC1 |
| InChI | InChI=1S/C17H22N2OS/c20-13-17(9-5-2-6-10-17)18-11-16-19-15(12-21-16)14-7-3-1-4-8-14/h1,3-4,7-8,12,18,20H,2,5-6,9-11,13H2 |
| InChIKey | GPRIVJMHOCQIBO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |