C17H19NO2S — CID 103449748
1-(1-hydroxycyclohexyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone (PubChem CID 103449748) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-(1-hydroxycyclohexyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(1-hydroxycyclohexyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 103449748 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-(1-hydroxycyclohexyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)cs1)C1(O)CCCCC1 |
| InChI | InChI=1S/C17H19NO2S/c19-15(17(20)9-5-2-6-10-17)11-16-18-14(12-21-16)13-7-3-1-4-8-13/h1,3-4,7-8,12,20H,2,5-6,9-11H2 |
| InChIKey | BUFQRCYPGBQKPQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |