C11H17NOS — CID 112645220
[1-(1,3-thiazol-5-ylmethyl)cyclohexyl]methanol (PubChem CID 112645220) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-ylmethyl)cyclohexyl]methanol.
| Compound Name | [1-(1,3-thiazol-5-ylmethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 112645220 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [1-(1,3-thiazol-5-ylmethyl)cyclohexyl]methanol |
| SMILES | OCC1(Cc2cncs2)CCCCC1 |
| InChI | InChI=1S/C11H17NOS/c13-8-11(4-2-1-3-5-11)6-10-7-12-9-14-10/h7,9,13H,1-6,8H2 |
| InChIKey | NRWUQVPPCQBMOU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |