C9H13NO2S — CID 112641803
4-(1,3-thiazol-5-ylmethyl)oxan-4-ol (PubChem CID 112641803) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 4-(1,3-thiazol-5-ylmethyl)oxan-4-ol.
| Compound Name | 4-(1,3-thiazol-5-ylmethyl)oxan-4-ol |
|---|---|
| PubChem CID | 112641803 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-(1,3-thiazol-5-ylmethyl)oxan-4-ol |
| SMILES | OC1(Cc2cncs2)CCOCC1 |
| InChI | InChI=1S/C9H13NO2S/c11-9(1-3-12-4-2-9)5-8-6-10-7-13-8/h6-7,11H,1-5H2 |
| InChIKey | CFQDDNPLJWBZOS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |