C9H13FN2S — CID 112645695
5-[(4-fluoropiperidin-4-yl)methyl]-1,3-thiazole (PubChem CID 112645695) has the molecular formula C9H13FN2S and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-[(4-fluoropiperidin-4-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(4-fluoropiperidin-4-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112645695 |
| Molecular Formula | C9H13FN2S |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-[(4-fluoropiperidin-4-yl)methyl]-1,3-thiazole |
| SMILES | FC1(Cc2cncs2)CCNCC1 |
| InChI | InChI=1S/C9H13FN2S/c10-9(1-3-11-4-2-9)5-8-6-12-7-13-8/h6-7,11H,1-5H2 |
| InChIKey | PGGCJKIPKCHDQF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |