C8H9NOS — CID 130672635
1-(1,3-thiazol-5-ylmethyl)cyclopropane-1-carbaldehyde (PubChem CID 130672635) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-(1,3-thiazol-5-ylmethyl)cyclopropane-1-carbaldehyde.
| Compound Name | 1-(1,3-thiazol-5-ylmethyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 130672635 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 1-(1,3-thiazol-5-ylmethyl)cyclopropane-1-carbaldehyde |
| SMILES | O=CC1(Cc2cncs2)CC1 |
| InChI | InChI=1S/C8H9NOS/c10-5-8(1-2-8)3-7-4-9-6-11-7/h4-6H,1-3H2 |
| InChIKey | IVHOYRZLKGKVAT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|