C11H15NO3S — CID 116748666
1-(4-methoxyoxan-4-yl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 116748666) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-(4-methoxyoxan-4-yl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-methoxyoxan-4-yl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116748666 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 1-(4-methoxyoxan-4-yl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | COC1(C(=O)Cc2cncs2)CCOCC1 |
| InChI | InChI=1S/C11H15NO3S/c1-14-11(2-4-15-5-3-11)10(13)6-9-7-12-8-16-9/h7-8H,2-6H2,1H3 |
| InChIKey | MLRBKAUOKHVFGD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |