C12H18N2O3 — CID 116748665
1-(4-methoxyoxan-4-yl)-2-(1-methylpyrazol-3-yl)ethanone (PubChem CID 116748665) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(4-methoxyoxan-4-yl)-2-(1-methylpyrazol-3-yl)ethanone.
| Compound Name | 1-(4-methoxyoxan-4-yl)-2-(1-methylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 116748665 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(4-methoxyoxan-4-yl)-2-(1-methylpyrazol-3-yl)ethanone |
| SMILES | COC1(C(=O)Cc2ccn(C)n2)CCOCC1 |
| InChI | InChI=1S/C12H18N2O3/c1-14-6-3-10(13-14)9-11(15)12(16-2)4-7-17-8-5-12/h3,6H,4-5,7-9H2,1-2H3 |
| InChIKey | BHOZYXJJFDKQMJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |