C6H10BrN3S — CID 131206979
5-[(2-bromoethylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 131206979) has the molecular formula C6H10BrN3S and a molecular weight of 236.14 g/mol. Its IUPAC name is 5-[(2-bromoethylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-bromoethylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131206979 |
| Molecular Formula | C6H10BrN3S |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 5-[(2-bromoethylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CNCCBr)s1 |
| InChI | InChI=1S/C6H10BrN3S/c7-1-2-9-3-5-4-10-6(8)11-5/h4,9H,1-3H2,(H2,8,10) |
| InChIKey | DFCQBEWBMUFCSP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|