C15H20ClN3S — CID 120899245
5-[[2-phenylethyl(prop-2-enyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120899245) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 5-[[2-phenylethyl(prop-2-enyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-[[2-phenylethyl(prop-2-enyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120899245 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[[2-phenylethyl(prop-2-enyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | C=CCN(CCc1ccccc1)Cc1cnc(N)s1.Cl |
| InChI | InChI=1S/C15H19N3S.ClH/c1-2-9-18(12-14-11-17-15(16)19-14)10-8-13-6-4-3-5-7-13;/h2-7,11H,1,8-10,12H2,(H2,16,17);1H |
| InChIKey | VVQNKQZIIISMGF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|