C12H16ClN3S2 — CID 120897652
5-[[prop-2-enyl(thiophen-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120897652) has the molecular formula C12H16ClN3S2 and a molecular weight of 301.87 g/mol. Its IUPAC name is 5-[[prop-2-enyl(thiophen-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-[[prop-2-enyl(thiophen-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120897652 |
| Molecular Formula | C12H16ClN3S2 |
| Molecular Weight | 301.87 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-[[prop-2-enyl(thiophen-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | C=CCN(Cc1cccs1)Cc1cnc(N)s1.Cl |
| InChI | InChI=1S/C12H15N3S2.ClH/c1-2-5-15(8-10-4-3-6-16-10)9-11-7-14-12(13)17-11;/h2-4,6-7H,1,5,8-9H2,(H2,13,14);1H |
| InChIKey | FEYGQEXEVUUJCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|