C19H25N3 — CID 71908815
N-ethyl-2-[[2-phenylethyl(prop-2-enyl)amino]methyl]pyridin-4-amine (PubChem CID 71908815) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-ethyl-2-[[2-phenylethyl(prop-2-enyl)amino]methyl]pyridin-4-amine.
| Compound Name | N-ethyl-2-[[2-phenylethyl(prop-2-enyl)amino]methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 71908815 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-ethyl-2-[[2-phenylethyl(prop-2-enyl)amino]methyl]pyridin-4-amine |
| SMILES | C=CCN(CCc1ccccc1)Cc1cc(NCC)ccn1 |
| InChI | InChI=1S/C19H25N3/c1-3-13-22(14-11-17-8-6-5-7-9-17)16-19-15-18(20-4-2)10-12-21-19/h3,5-10,12,15H,1,4,11,13-14,16H2,2H3,(H,20,21) |
| InChIKey | SEOSCQYAGLSKLA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|