C13H17ClN4O2S — CID 120905813
5-[[methyl-[2-(3-nitrophenyl)ethyl]amino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120905813) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.82 g/mol. Its IUPAC name is 5-[[methyl-[2-(3-nitrophenyl)ethyl]amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-[[methyl-[2-(3-nitrophenyl)ethyl]amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120905813 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-[[methyl-[2-(3-nitrophenyl)ethyl]amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CN(CCc1cccc([N+](=O)[O-])c1)Cc1cnc(N)s1.Cl |
| InChI | InChI=1S/C13H16N4O2S.ClH/c1-16(9-12-8-15-13(14)20-12)6-5-10-3-2-4-11(7-10)17(18)19;/h2-4,7-8H,5-6,9H2,1H3,(H2,14,15);1H |
| InChIKey | SNTKBQCOEFUBTD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|