C14H18N4O2S — CID 120899158
5-[[(4-nitrophenyl)methyl-propan-2-ylamino]methyl]-1,3-thiazol-2-amine (PubChem CID 120899158) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-[[(4-nitrophenyl)methyl-propan-2-ylamino]methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[[(4-nitrophenyl)methyl-propan-2-ylamino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120899158 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-[[(4-nitrophenyl)methyl-propan-2-ylamino]methyl]-1,3-thiazol-2-amine |
| SMILES | CC(C)N(Cc1ccc([N+](=O)[O-])cc1)Cc1cnc(N)s1 |
| InChI | InChI=1S/C14H18N4O2S/c1-10(2)17(9-13-7-16-14(15)21-13)8-11-3-5-12(6-4-11)18(19)20/h3-7,10H,8-9H2,1-2H3,(H2,15,16) |
| InChIKey | JMHDUQSOMAMMQR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|