C16H20ClN3O2 — CID 102538107
3-(5-chloro-2-propoxyphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 102538107) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-(5-chloro-2-propoxyphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(5-chloro-2-propoxyphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102538107 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-(5-chloro-2-propoxyphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | CCCOc1ccc(Cl)cc1-c1noc(C2CCCCN2)n1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-2-9-21-14-7-6-11(17)10-12(14)15-19-16(22-20-15)13-5-3-4-8-18-13/h6-7,10,13,18H,2-5,8-9H2,1H3 |
| InChIKey | ZGUXBGQEUVEYCY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |