C17H17N3O — CID 103832593
3-naphthalen-1-yl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 103832593) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-naphthalen-1-yl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-naphthalen-1-yl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103832593 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-naphthalen-1-yl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2c(-c3noc([C@@H]4CCCCN4)n3)cccc2c1 |
| InChI | InChI=1S/C17H17N3O/c1-2-8-13-12(6-1)7-5-9-14(13)16-19-17(21-20-16)15-10-3-4-11-18-15/h1-2,5-9,15,18H,3-4,10-11H2/t15-/m0/s1 |
| InChIKey | PDYIGJZKYHIAJW-HNNXBMFYSA-N |
| XLogP | 3.70 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |