C15H15N3O2 — CID 103832711
3-(1-benzofuran-2-yl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 103832711) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-benzofuran-2-yl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103832711 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2oc(-c3noc([C@H]4CCCCN4)n3)cc2c1 |
| InChI | InChI=1S/C15H15N3O2/c1-2-7-12-10(5-1)9-13(19-12)14-17-15(20-18-14)11-6-3-4-8-16-11/h1-2,5,7,9,11,16H,3-4,6,8H2/t11-/m1/s1 |
| InChIKey | MOWIFGLJQJSHMK-LLVKDONJSA-N |
| XLogP | 3.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |