C14H13N3O2 — CID 95012274
3-(1-benzofuran-2-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 95012274) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-benzofuran-2-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95012274 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2oc(-c3noc([C@H]4CCCN4)n3)cc2c1 |
| InChI | InChI=1S/C14H13N3O2/c1-2-6-11-9(4-1)8-12(18-11)13-16-14(19-17-13)10-5-3-7-15-10/h1-2,4,6,8,10,15H,3,5,7H2/t10-/m1/s1 |
| InChIKey | NWTHKQLCOOMRFB-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |