C12H12ClN3O2 — CID 102538463
propan-2-yl 2-chloro-4-(1,2,4-triazol-4-yl)benzoate (PubChem CID 102538463) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is propan-2-yl 2-chloro-4-(1,2,4-triazol-4-yl)benzoate.
| Compound Name | propan-2-yl 2-chloro-4-(1,2,4-triazol-4-yl)benzoate |
|---|---|
| PubChem CID | 102538463 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | propan-2-yl 2-chloro-4-(1,2,4-triazol-4-yl)benzoate |
| SMILES | CC(C)OC(=O)c1ccc(-n2cnnc2)cc1Cl |
| InChI | InChI=1S/C12H12ClN3O2/c1-8(2)18-12(17)10-4-3-9(5-11(10)13)16-6-14-15-7-16/h3-8H,1-2H3 |
| InChIKey | VGUJSNMVNWDQJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |