C20H21N3 — CID 102544727
5-[amino(phenyl)methyl]-N,3-dimethyl-N-phenylpyridin-2-amine (PubChem CID 102544727) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-[amino(phenyl)methyl]-N,3-dimethyl-N-phenylpyridin-2-amine.
| Compound Name | 5-[amino(phenyl)methyl]-N,3-dimethyl-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 102544727 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-[amino(phenyl)methyl]-N,3-dimethyl-N-phenylpyridin-2-amine |
| SMILES | Cc1cc(C(N)c2ccccc2)cnc1N(C)c1ccccc1 |
| InChI | InChI=1S/C20H21N3/c1-15-13-17(19(21)16-9-5-3-6-10-16)14-22-20(15)23(2)18-11-7-4-8-12-18/h3-14,19H,21H2,1-2H3 |
| InChIKey | XITCQCZZTWDLSJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |