C26H31N3O6 — CID 10254616
3-O-tert-butyl 5-O-methyl 5-phenyl-2-[1-(phenylmethoxycarbonylamino)ethyl]-4H-imidazole-3,5-dicarboxylate (PubChem CID 10254616) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-methyl 5-phenyl-2-[1-(phenylmethoxycarbonylamino)ethyl]-4H-imidazole-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-methyl 5-phenyl-2-[1-(phenylmethoxycarbonylamino)ethyl]-4H-imidazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10254616 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 3-O-tert-butyl 5-O-methyl 5-phenyl-2-[1-(phenylmethoxycarbonylamino)ethyl]-4H-imidazole-3,5-dicarboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CN(C(=O)OC(C)(C)C)C(C(C)NC(=O)OCc2ccccc2)=N1 |
| InChI | InChI=1S/C26H31N3O6/c1-18(27-23(31)34-16-19-12-8-6-9-13-19)21-28-26(22(30)33-5,20-14-10-7-11-15-20)17-29(21)24(32)35-25(2,3)4/h6-15,18H,16-17H2,1-5H3,(H,27,31) |
| InChIKey | JTJGQDDZZZKALW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|