C8H9NO2S — CID 102548401
N-(oxiran-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 102548401) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(oxiran-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-(oxiran-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 102548401 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | N-(oxiran-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CO1)c1cccs1 |
| InChI | InChI=1S/C8H9NO2S/c10-8(7-2-1-3-12-7)9-4-6-5-11-6/h1-3,6H,4-5H2,(H,9,10) |
| InChIKey | SKAIURPHIACWKB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|