C17H17NO4S — CID 97013902
N-[[(2R)-1,4-dioxan-2-yl]methyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 97013902) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[[(2R)-1,4-dioxan-2-yl]methyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 97013902 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | O=C(NC[C@@H]1COCCO1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C17H17NO4S/c19-16(15-6-3-9-23-15)13-4-1-2-5-14(13)17(20)18-10-12-11-21-7-8-22-12/h1-6,9,12H,7-8,10-11H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | CVYHFZPFQBQWCS-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |