C16H22N2O4 — CID 77086310
N-(1,4-dioxan-2-ylmethyl)-2-morpholin-4-ylbenzamide (PubChem CID 77086310) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-morpholin-4-ylbenzamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 77086310 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-morpholin-4-ylbenzamide |
| SMILES | O=C(NCC1COCCO1)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H22N2O4/c19-16(17-11-13-12-21-9-10-22-13)14-3-1-2-4-15(14)18-5-7-20-8-6-18/h1-4,13H,5-12H2,(H,17,19) |
| InChIKey | AKZMIYONLKNKCT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |