C12H14N4O — CID 102548974
3-(pyrrolidin-2-ylmethyl)pyrido[3,4-d]pyridazin-4-one (PubChem CID 102548974) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 3-(pyrrolidin-2-ylmethyl)pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 3-(pyrrolidin-2-ylmethyl)pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 102548974 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(pyrrolidin-2-ylmethyl)pyrido[3,4-d]pyridazin-4-one |
| SMILES | O=c1c2cnccc2cnn1CC1CCCN1 |
| InChI | InChI=1S/C12H14N4O/c17-12-11-7-13-5-3-9(11)6-15-16(12)8-10-2-1-4-14-10/h3,5-7,10,14H,1-2,4,8H2 |
| InChIKey | PJRMOEPYSDQAIM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |