C14H15N3O — CID 21196558
1-(pyrrolidin-2-ylmethyl)furo[2,3-g]indazole (PubChem CID 21196558) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(pyrrolidin-2-ylmethyl)furo[2,3-g]indazole.
| Compound Name | 1-(pyrrolidin-2-ylmethyl)furo[2,3-g]indazole |
|---|---|
| PubChem CID | 21196558 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-(pyrrolidin-2-ylmethyl)furo[2,3-g]indazole |
| SMILES | c1cc2c(ccc3cnn(CC4CCCN4)c32)o1 |
| InChI | InChI=1S/C14H15N3O/c1-2-11(15-6-1)9-17-14-10(8-16-17)3-4-13-12(14)5-7-18-13/h3-5,7-8,11,15H,1-2,6,9H2 |
| InChIKey | OEFSKRAPGHLNBO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |