C13H13N5O — CID 21196684
1-(2-azidobutyl)furo[2,3-g]indazole (PubChem CID 21196684) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-(2-azidobutyl)furo[2,3-g]indazole.
| Compound Name | 1-(2-azidobutyl)furo[2,3-g]indazole |
|---|---|
| PubChem CID | 21196684 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(2-azidobutyl)furo[2,3-g]indazole |
| SMILES | CCC(Cn1ncc2ccc3occc3c21)N=[N+]=[N-] |
| InChI | InChI=1S/C13H13N5O/c1-2-10(16-17-14)8-18-13-9(7-15-18)3-4-12-11(13)5-6-19-12/h3-7,10H,2,8H2,1H3 |
| InChIKey | PAPQJZALEDPHQI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|