C15H16IN3O — CID 70231381
3-iodo-1-(piperidin-3-ylmethyl)furo[2,3-g]indazole (PubChem CID 70231381) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is 3-iodo-1-(piperidin-3-ylmethyl)furo[2,3-g]indazole.
| Compound Name | 3-iodo-1-(piperidin-3-ylmethyl)furo[2,3-g]indazole |
|---|---|
| PubChem CID | 70231381 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-iodo-1-(piperidin-3-ylmethyl)furo[2,3-g]indazole |
| SMILES | Ic1nn(CC2CCCNC2)c2c1ccc1occc12 |
| InChI | InChI=1S/C15H16IN3O/c16-15-12-3-4-13-11(5-7-20-13)14(12)19(18-15)9-10-2-1-6-17-8-10/h3-5,7,10,17H,1-2,6,8-9H2 |
| InChIKey | YXIPLZJLHKGHDK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|