C9H13I2N3 — CID 130508481
3-[(4,5-diiodoimidazol-1-yl)methyl]piperidine (PubChem CID 130508481) has the molecular formula C9H13I2N3 and a molecular weight of 417.03 g/mol. Its IUPAC name is 3-[(4,5-diiodoimidazol-1-yl)methyl]piperidine.
| Compound Name | 3-[(4,5-diiodoimidazol-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 130508481 |
| Molecular Formula | C9H13I2N3 |
| Molecular Weight | 417.03 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | 3-[(4,5-diiodoimidazol-1-yl)methyl]piperidine |
| SMILES | Ic1ncn(CC2CCCNC2)c1I |
| InChI | InChI=1S/C9H13I2N3/c10-8-9(11)14(6-13-8)5-7-2-1-3-12-4-7/h6-7,12H,1-5H2 |
| InChIKey | HIPQYBIFGVRGCX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.03 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|