C11H16N6 — CID 68898401
9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine (PubChem CID 68898401) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine.
| Compound Name | 9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 68898401 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
| SMILES | Nc1ncc2ncn(C[C@@H]3CCCNC3)c2n1 |
| InChI | InChI=1S/C11H16N6/c12-11-14-5-9-10(16-11)17(7-15-9)6-8-2-1-3-13-4-8/h5,7-8,13H,1-4,6H2,(H2,12,14,16)/t8-/m1/s1 |
| InChIKey | ZGWDSZNZWSXZAE-MRVPVSSYSA-N |
| XLogP | 0.41 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |